C19H19F3N2O3 — CID 55904816
N-[2-(2,3-dihydro-1H-inden-5-yloxy)ethyl]-2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetamide (PubChem CID 55904816) has the molecular formula C19H19F3N2O3 and a molecular weight of 380.37 g/mol. Its IUPAC name is N-[2-(2,3-dihydro-1H-inden-5-yloxy)ethyl]-2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetamide.
| Compound Name | N-[2-(2,3-dihydro-1H-inden-5-yloxy)ethyl]-2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetamide |
|---|---|
| PubChem CID | 55904816 |
| Molecular Formula | C19H19F3N2O3 |
| Molecular Weight | 380.37 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | N-[2-(2,3-dihydro-1H-inden-5-yloxy)ethyl]-2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetamide |
| SMILES | O=C(Cn1cc(C(F)(F)F)ccc1=O)NCCOc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C19H19F3N2O3/c20-19(21,22)15-5-7-18(26)24(11-15)12-17(25)23-8-9-27-16-6-4-13-2-1-3-14(13)10-16/h4-7,10-11H,1-3,8-9,12H2,(H,23,25) |
| InChIKey | CQZACYVWSYJEML-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.37 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|