C12H12Cl2N4O2S — CID 154769744
N-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-2-(1,2-thiazol-3-yloxy)acetamide (PubChem CID 154769744) has the molecular formula C12H12Cl2N4O2S and a molecular weight of 347.23 g/mol. Its IUPAC name is N-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-2-(1,2-thiazol-3-yloxy)acetamide.
| Compound Name | N-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-2-(1,2-thiazol-3-yloxy)acetamide |
|---|---|
| PubChem CID | 154769744 |
| Molecular Formula | C12H12Cl2N4O2S |
| Molecular Weight | 347.23 g/mol |
| Exact Mass | 346.01 |
| IUPAC Name | N-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-2-(1,2-thiazol-3-yloxy)acetamide |
| SMILES | O=C(COc1ccsn1)NCCNc1ncc(Cl)cc1Cl |
| InChI | InChI=1S/C12H12Cl2N4O2S/c13-8-5-9(14)12(17-6-8)16-3-2-15-10(19)7-20-11-1-4-21-18-11/h1,4-6H,2-3,7H2,(H,15,19)(H,16,17) |
| InChIKey | IMORUAHCSNPMLK-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.23 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|