C9H11F3N6O3 — CID 159994113
N-[2-(2-carbamoylhydrazinyl)-2-oxoethyl]-1-methyl-3-(trifluoromethyl)pyrazole-4-carboxamide (PubChem CID 159994113) has the molecular formula C9H11F3N6O3 and a molecular weight of 308.22 g/mol. Its IUPAC name is N-[2-(2-carbamoylhydrazinyl)-2-oxoethyl]-1-methyl-3-(trifluoromethyl)pyrazole-4-carboxamide.
| Compound Name | N-[2-(2-carbamoylhydrazinyl)-2-oxoethyl]-1-methyl-3-(trifluoromethyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 159994113 |
| Molecular Formula | C9H11F3N6O3 |
| Molecular Weight | 308.22 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | N-[2-(2-carbamoylhydrazinyl)-2-oxoethyl]-1-methyl-3-(trifluoromethyl)pyrazole-4-carboxamide |
| SMILES | Cn1cc(C(=O)NCC(=O)NNC(N)=O)c(C(F)(F)F)n1 |
| InChI | InChI=1S/C9H11F3N6O3/c1-18-3-4(6(17-18)9(10,11)12)7(20)14-2-5(19)15-16-8(13)21/h3H,2H2,1H3,(H,14,20)(H,15,19)(H3,13,16,21) |
| InChIKey | OHICGSIUZYYXOT-UHFFFAOYSA-N |
| XLogP | -1.13 |
| TPSA | 131.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.22 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|