C12H11BrF3N5O2 — CID 87008601
N'-(4-bromo-1-methylpyrrole-2-carbonyl)-1-methyl-3-(trifluoromethyl)pyrazole-4-carbohydrazide (PubChem CID 87008601) has the molecular formula C12H11BrF3N5O2 and a molecular weight of 394.15 g/mol. Its IUPAC name is N'-(4-bromo-1-methylpyrrole-2-carbonyl)-1-methyl-3-(trifluoromethyl)pyrazole-4-carbohydrazide.
| Compound Name | N'-(4-bromo-1-methylpyrrole-2-carbonyl)-1-methyl-3-(trifluoromethyl)pyrazole-4-carbohydrazide |
|---|---|
| PubChem CID | 87008601 |
| Molecular Formula | C12H11BrF3N5O2 |
| Molecular Weight | 394.15 g/mol |
| Exact Mass | 393.00 |
| IUPAC Name | N'-(4-bromo-1-methylpyrrole-2-carbonyl)-1-methyl-3-(trifluoromethyl)pyrazole-4-carbohydrazide |
| SMILES | Cn1cc(C(=O)NNC(=O)c2cc(Br)cn2C)c(C(F)(F)F)n1 |
| InChI | InChI=1S/C12H11BrF3N5O2/c1-20-4-6(13)3-8(20)11(23)18-17-10(22)7-5-21(2)19-9(7)12(14,15)16/h3-5H,1-2H3,(H,17,22)(H,18,23) |
| InChIKey | LCYHCAHMCPJANR-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 80.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.15 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|