C14H12BrF2N3O3 — CID 31293480
4-bromo-N'-[2-(difluoromethoxy)benzoyl]-1-methylpyrrole-2-carbohydrazide (PubChem CID 31293480) has the molecular formula C14H12BrF2N3O3 and a molecular weight of 388.17 g/mol. Its IUPAC name is 4-bromo-N'-[2-(difluoromethoxy)benzoyl]-1-methylpyrrole-2-carbohydrazide.
| Compound Name | 4-bromo-N'-[2-(difluoromethoxy)benzoyl]-1-methylpyrrole-2-carbohydrazide |
|---|---|
| PubChem CID | 31293480 |
| Molecular Formula | C14H12BrF2N3O3 |
| Molecular Weight | 388.17 g/mol |
| Exact Mass | 387.00 |
| IUPAC Name | 4-bromo-N'-[2-(difluoromethoxy)benzoyl]-1-methylpyrrole-2-carbohydrazide |
| SMILES | Cn1cc(Br)cc1C(=O)NNC(=O)c1ccccc1OC(F)F |
| InChI | InChI=1S/C14H12BrF2N3O3/c1-20-7-8(15)6-10(20)13(22)19-18-12(21)9-4-2-3-5-11(9)23-14(16)17/h2-7,14H,1H3,(H,18,21)(H,19,22) |
| InChIKey | DICWMGAFABPKBQ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 72.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.17 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|