C17H16BrN5O4 — CID 31315212
4-bromo-1-methyl-N'-[2-[(5-methyl-1,2,4-oxadiazol-3-yl)methoxy]benzoyl]pyrrole-2-carbohydrazide (PubChem CID 31315212) has the molecular formula C17H16BrN5O4 and a molecular weight of 434.25 g/mol. Its IUPAC name is 4-bromo-1-methyl-N'-[2-[(5-methyl-1,2,4-oxadiazol-3-yl)methoxy]benzoyl]pyrrole-2-carbohydrazide.
| Compound Name | 4-bromo-1-methyl-N'-[2-[(5-methyl-1,2,4-oxadiazol-3-yl)methoxy]benzoyl]pyrrole-2-carbohydrazide |
|---|---|
| PubChem CID | 31315212 |
| Molecular Formula | C17H16BrN5O4 |
| Molecular Weight | 434.25 g/mol |
| Exact Mass | 433.04 |
| IUPAC Name | 4-bromo-1-methyl-N'-[2-[(5-methyl-1,2,4-oxadiazol-3-yl)methoxy]benzoyl]pyrrole-2-carbohydrazide |
| SMILES | Cc1nc(COc2ccccc2C(=O)NNC(=O)c2cc(Br)cn2C)no1 |
| InChI | InChI=1S/C17H16BrN5O4/c1-10-19-15(22-27-10)9-26-14-6-4-3-5-12(14)16(24)20-21-17(25)13-7-11(18)8-23(13)2/h3-8H,9H2,1-2H3,(H,20,24)(H,21,25) |
| InChIKey | WTOVRLDESZGHPL-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 111.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.25 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|