C13H11BrF2N4O2S — CID 24552609
N'-(4-bromo-1-methylpyrrole-2-carbonyl)-2-(difluoromethylsulfanyl)pyridine-3-carbohydrazide (PubChem CID 24552609) has the molecular formula C13H11BrF2N4O2S and a molecular weight of 405.22 g/mol. Its IUPAC name is N'-(4-bromo-1-methylpyrrole-2-carbonyl)-2-(difluoromethylsulfanyl)pyridine-3-carbohydrazide.
| Compound Name | N'-(4-bromo-1-methylpyrrole-2-carbonyl)-2-(difluoromethylsulfanyl)pyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 24552609 |
| Molecular Formula | C13H11BrF2N4O2S |
| Molecular Weight | 405.22 g/mol |
| Exact Mass | 403.98 |
| IUPAC Name | N'-(4-bromo-1-methylpyrrole-2-carbonyl)-2-(difluoromethylsulfanyl)pyridine-3-carbohydrazide |
| SMILES | Cn1cc(Br)cc1C(=O)NNC(=O)c1cccnc1SC(F)F |
| InChI | InChI=1S/C13H11BrF2N4O2S/c1-20-6-7(14)5-9(20)11(22)19-18-10(21)8-3-2-4-17-12(8)23-13(15)16/h2-6,13H,1H3,(H,18,21)(H,19,22) |
| InChIKey | FOEDQJRGZGOBNM-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.22 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|