C12H10F2N4O2S — CID 78813989
2-(difluoromethylsulfanyl)-N'-(1H-pyrrole-2-carbonyl)pyridine-3-carbohydrazide (PubChem CID 78813989) has the molecular formula C12H10F2N4O2S and a molecular weight of 312.30 g/mol. Its IUPAC name is 2-(difluoromethylsulfanyl)-N'-(1H-pyrrole-2-carbonyl)pyridine-3-carbohydrazide.
| Compound Name | 2-(difluoromethylsulfanyl)-N'-(1H-pyrrole-2-carbonyl)pyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 78813989 |
| Molecular Formula | C12H10F2N4O2S |
| Molecular Weight | 312.30 g/mol |
| Exact Mass | 312.05 |
| IUPAC Name | 2-(difluoromethylsulfanyl)-N'-(1H-pyrrole-2-carbonyl)pyridine-3-carbohydrazide |
| SMILES | O=C(NNC(=O)c1cccnc1SC(F)F)c1ccc[nH]1 |
| InChI | InChI=1S/C12H10F2N4O2S/c13-12(14)21-11-7(3-1-6-16-11)9(19)17-18-10(20)8-4-2-5-15-8/h1-6,12,15H,(H,17,19)(H,18,20) |
| InChIKey | ZVYYWEZOWOZKKW-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.30 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|