C15H14F2N2OS2 — CID 78810821
2-(difluoromethylsulfanyl)-N-(2-phenylsulfanylethyl)pyridine-3-carboxamide (PubChem CID 78810821) has the molecular formula C15H14F2N2OS2 and a molecular weight of 340.42 g/mol. Its IUPAC name is 2-(difluoromethylsulfanyl)-N-(2-phenylsulfanylethyl)pyridine-3-carboxamide.
| Compound Name | 2-(difluoromethylsulfanyl)-N-(2-phenylsulfanylethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 78810821 |
| Molecular Formula | C15H14F2N2OS2 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.05 |
| IUPAC Name | 2-(difluoromethylsulfanyl)-N-(2-phenylsulfanylethyl)pyridine-3-carboxamide |
| SMILES | O=C(NCCSc1ccccc1)c1cccnc1SC(F)F |
| InChI | InChI=1S/C15H14F2N2OS2/c16-15(17)22-14-12(7-4-8-19-14)13(20)18-9-10-21-11-5-2-1-3-6-11/h1-8,15H,9-10H2,(H,18,20) |
| InChIKey | AJOZSMTZKHYGKD-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|