C21H18F2N2O2S — CID 55954790
2-(difluoromethylsulfanyl)-N-[[3-(phenoxymethyl)phenyl]methyl]pyridine-3-carboxamide (PubChem CID 55954790) has the molecular formula C21H18F2N2O2S and a molecular weight of 400.45 g/mol. Its IUPAC name is 2-(difluoromethylsulfanyl)-N-[[3-(phenoxymethyl)phenyl]methyl]pyridine-3-carboxamide.
| Compound Name | 2-(difluoromethylsulfanyl)-N-[[3-(phenoxymethyl)phenyl]methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 55954790 |
| Molecular Formula | C21H18F2N2O2S |
| Molecular Weight | 400.45 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | 2-(difluoromethylsulfanyl)-N-[[3-(phenoxymethyl)phenyl]methyl]pyridine-3-carboxamide |
| SMILES | O=C(NCc1cccc(COc2ccccc2)c1)c1cccnc1SC(F)F |
| InChI | InChI=1S/C21H18F2N2O2S/c22-21(23)28-20-18(10-5-11-24-20)19(26)25-13-15-6-4-7-16(12-15)14-27-17-8-2-1-3-9-17/h1-12,21H,13-14H2,(H,25,26) |
| InChIKey | NEHAXBUIFIFTQE-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.45 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |