C18H22BrN3O4 — CID 27037306
4-bromo-N'-[4-(2-ethoxyphenoxy)butanoyl]-1-methylpyrrole-2-carbohydrazide (PubChem CID 27037306) has the molecular formula C18H22BrN3O4 and a molecular weight of 424.30 g/mol. Its IUPAC name is 4-bromo-N'-[4-(2-ethoxyphenoxy)butanoyl]-1-methylpyrrole-2-carbohydrazide.
| Compound Name | 4-bromo-N'-[4-(2-ethoxyphenoxy)butanoyl]-1-methylpyrrole-2-carbohydrazide |
|---|---|
| PubChem CID | 27037306 |
| Molecular Formula | C18H22BrN3O4 |
| Molecular Weight | 424.30 g/mol |
| Exact Mass | 423.08 |
| IUPAC Name | 4-bromo-N'-[4-(2-ethoxyphenoxy)butanoyl]-1-methylpyrrole-2-carbohydrazide |
| SMILES | CCOc1ccccc1OCCCC(=O)NNC(=O)c1cc(Br)cn1C |
| InChI | InChI=1S/C18H22BrN3O4/c1-3-25-15-7-4-5-8-16(15)26-10-6-9-17(23)20-21-18(24)14-11-13(19)12-22(14)2/h4-5,7-8,11-12H,3,6,9-10H2,1-2H3,(H,20,23)(H,21,24) |
| InChIKey | URQCUKIJABPJOW-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.30 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|