C18H19BrN4O2 — CID 27036776
4-bromo-N'-[4-(1H-indol-3-yl)butanoyl]-1-methylpyrrole-2-carbohydrazide (PubChem CID 27036776) has the molecular formula C18H19BrN4O2 and a molecular weight of 403.28 g/mol. Its IUPAC name is 4-bromo-N'-[4-(1H-indol-3-yl)butanoyl]-1-methylpyrrole-2-carbohydrazide.
| Compound Name | 4-bromo-N'-[4-(1H-indol-3-yl)butanoyl]-1-methylpyrrole-2-carbohydrazide |
|---|---|
| PubChem CID | 27036776 |
| Molecular Formula | C18H19BrN4O2 |
| Molecular Weight | 403.28 g/mol |
| Exact Mass | 402.07 |
| IUPAC Name | 4-bromo-N'-[4-(1H-indol-3-yl)butanoyl]-1-methylpyrrole-2-carbohydrazide |
| SMILES | Cn1cc(Br)cc1C(=O)NNC(=O)CCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C18H19BrN4O2/c1-23-11-13(19)9-16(23)18(25)22-21-17(24)8-4-5-12-10-20-15-7-3-2-6-14(12)15/h2-3,6-7,9-11,20H,4-5,8H2,1H3,(H,21,24)(H,22,25) |
| InChIKey | QPVDFAAYKGKKFH-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 78.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.28 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|