C14H14N6O2 — CID 100694106
N'-[2-(1H-indol-3-yl)acetyl]-3-methyltriazole-4-carbohydrazide (PubChem CID 100694106) has the molecular formula C14H14N6O2 and a molecular weight of 298.31 g/mol. Its IUPAC name is N'-[2-(1H-indol-3-yl)acetyl]-3-methyltriazole-4-carbohydrazide.
| Compound Name | N'-[2-(1H-indol-3-yl)acetyl]-3-methyltriazole-4-carbohydrazide |
|---|---|
| PubChem CID | 100694106 |
| Molecular Formula | C14H14N6O2 |
| Molecular Weight | 298.31 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | N'-[2-(1H-indol-3-yl)acetyl]-3-methyltriazole-4-carbohydrazide |
| SMILES | Cn1nncc1C(=O)NNC(=O)Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C14H14N6O2/c1-20-12(8-16-19-20)14(22)18-17-13(21)6-9-7-15-11-5-3-2-4-10(9)11/h2-5,7-8,15H,6H2,1H3,(H,17,21)(H,18,22) |
| InChIKey | WFBPFPYHUAOWOU-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 104.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.31 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|