C22H21N3O3 — CID 26873945
N'-[4-(1H-indol-3-yl)butanoyl]-3-methyl-1-benzofuran-2-carbohydrazide (PubChem CID 26873945) has the molecular formula C22H21N3O3 and a molecular weight of 375.43 g/mol. Its IUPAC name is N'-[4-(1H-indol-3-yl)butanoyl]-3-methyl-1-benzofuran-2-carbohydrazide.
| Compound Name | N'-[4-(1H-indol-3-yl)butanoyl]-3-methyl-1-benzofuran-2-carbohydrazide |
|---|---|
| PubChem CID | 26873945 |
| Molecular Formula | C22H21N3O3 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | N'-[4-(1H-indol-3-yl)butanoyl]-3-methyl-1-benzofuran-2-carbohydrazide |
| SMILES | Cc1c(C(=O)NNC(=O)CCCc2c[nH]c3ccccc23)oc2ccccc12 |
| InChI | InChI=1S/C22H21N3O3/c1-14-16-8-3-5-11-19(16)28-21(14)22(27)25-24-20(26)12-6-7-15-13-23-18-10-4-2-9-17(15)18/h2-5,8-11,13,23H,6-7,12H2,1H3,(H,24,26)(H,25,27) |
| InChIKey | AHXZDBPUYAZPIH-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 87.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|