C14H14BrF2N3O2 — CID 19297512
N-[3-(4-bromopyrazol-1-yl)propyl]-2-(difluoromethoxy)benzamide (PubChem CID 19297512) has the molecular formula C14H14BrF2N3O2 and a molecular weight of 374.19 g/mol. Its IUPAC name is N-[3-(4-bromopyrazol-1-yl)propyl]-2-(difluoromethoxy)benzamide.
| Compound Name | N-[3-(4-bromopyrazol-1-yl)propyl]-2-(difluoromethoxy)benzamide |
|---|---|
| PubChem CID | 19297512 |
| Molecular Formula | C14H14BrF2N3O2 |
| Molecular Weight | 374.19 g/mol |
| Exact Mass | 373.02 |
| IUPAC Name | N-[3-(4-bromopyrazol-1-yl)propyl]-2-(difluoromethoxy)benzamide |
| SMILES | O=C(NCCCn1cc(Br)cn1)c1ccccc1OC(F)F |
| InChI | InChI=1S/C14H14BrF2N3O2/c15-10-8-19-20(9-10)7-3-6-18-13(21)11-4-1-2-5-12(11)22-14(16)17/h1-2,4-5,8-9,14H,3,6-7H2,(H,18,21) |
| InChIKey | CNUIFODKETXZIH-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.19 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|