C13H14F2N4O2 — CID 115319564
N-[2-(4-aminopyrazol-1-yl)ethyl]-2-(difluoromethoxy)benzamide (PubChem CID 115319564) has the molecular formula C13H14F2N4O2 and a molecular weight of 296.28 g/mol. Its IUPAC name is N-[2-(4-aminopyrazol-1-yl)ethyl]-2-(difluoromethoxy)benzamide.
| Compound Name | N-[2-(4-aminopyrazol-1-yl)ethyl]-2-(difluoromethoxy)benzamide |
|---|---|
| PubChem CID | 115319564 |
| Molecular Formula | C13H14F2N4O2 |
| Molecular Weight | 296.28 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | N-[2-(4-aminopyrazol-1-yl)ethyl]-2-(difluoromethoxy)benzamide |
| SMILES | Nc1cnn(CCNC(=O)c2ccccc2OC(F)F)c1 |
| InChI | InChI=1S/C13H14F2N4O2/c14-13(15)21-11-4-2-1-3-10(11)12(20)17-5-6-19-8-9(16)7-18-19/h1-4,7-8,13H,5-6,16H2,(H,17,20) |
| InChIKey | LKYFIPSCVFIPSR-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.28 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |