C11H12F3N3O4 — CID 104743648
3-[2-(2,2,2-trifluoroethoxy)ethylcarbamoylamino]pyridine-2-carboxylic acid (PubChem CID 104743648) has the molecular formula C11H12F3N3O4 and a molecular weight of 307.23 g/mol. Its IUPAC name is 3-[2-(2,2,2-trifluoroethoxy)ethylcarbamoylamino]pyridine-2-carboxylic acid.
| Compound Name | 3-[2-(2,2,2-trifluoroethoxy)ethylcarbamoylamino]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 104743648 |
| Molecular Formula | C11H12F3N3O4 |
| Molecular Weight | 307.23 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | 3-[2-(2,2,2-trifluoroethoxy)ethylcarbamoylamino]pyridine-2-carboxylic acid |
| SMILES | O=C(NCCOCC(F)(F)F)Nc1cccnc1C(=O)O |
| InChI | InChI=1S/C11H12F3N3O4/c12-11(13,14)6-21-5-4-16-10(20)17-7-2-1-3-15-8(7)9(18)19/h1-3H,4-6H2,(H,18,19)(H2,16,17,20) |
| InChIKey | YYUVKMXYDLENHS-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.23 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|