C12H17N3O4 — CID 113447920
3-(1-methoxybutan-2-ylcarbamoylamino)pyridine-2-carboxylic acid (PubChem CID 113447920) has the molecular formula C12H17N3O4 and a molecular weight of 267.28 g/mol. Its IUPAC name is 3-(1-methoxybutan-2-ylcarbamoylamino)pyridine-2-carboxylic acid.
| Compound Name | 3-(1-methoxybutan-2-ylcarbamoylamino)pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 113447920 |
| Molecular Formula | C12H17N3O4 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | 3-(1-methoxybutan-2-ylcarbamoylamino)pyridine-2-carboxylic acid |
| SMILES | CCC(COC)NC(=O)Nc1cccnc1C(=O)O |
| InChI | InChI=1S/C12H17N3O4/c1-3-8(7-19-2)14-12(18)15-9-5-4-6-13-10(9)11(16)17/h4-6,8H,3,7H2,1-2H3,(H,16,17)(H2,14,15,18) |
| InChIKey | HWMCZSXWCMGIBL-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |