C23H28N4OS — CID 50840299
2-(4-benzylsulfanylpyrrolo[3,2-c]pyridin-1-yl)-N-(3-pyrrolidin-1-ylpropyl)acetamide (PubChem CID 50840299) has the molecular formula C23H28N4OS and a molecular weight of 408.57 g/mol. Its IUPAC name is 2-(4-benzylsulfanylpyrrolo[3,2-c]pyridin-1-yl)-N-(3-pyrrolidin-1-ylpropyl)acetamide.
| Compound Name | 2-(4-benzylsulfanylpyrrolo[3,2-c]pyridin-1-yl)-N-(3-pyrrolidin-1-ylpropyl)acetamide |
|---|---|
| PubChem CID | 50840299 |
| Molecular Formula | C23H28N4OS |
| Molecular Weight | 408.57 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | 2-(4-benzylsulfanylpyrrolo[3,2-c]pyridin-1-yl)-N-(3-pyrrolidin-1-ylpropyl)acetamide |
| SMILES | O=C(Cn1ccc2c(SCc3ccccc3)nccc21)NCCCN1CCCC1 |
| InChI | InChI=1S/C23H28N4OS/c28-22(24-11-6-15-26-13-4-5-14-26)17-27-16-10-20-21(27)9-12-25-23(20)29-18-19-7-2-1-3-8-19/h1-3,7-10,12,16H,4-6,11,13-15,17-18H2,(H,24,28) |
| InChIKey | IPPYXEVKAGSXIZ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.57 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|