About 5-(ethylcarbamoylamino)-3-ethylsulfanyl-1,2-thiazole-4-carboxamide
5-(ethylcarbamoylamino)-3-ethylsulfanyl-1,2-thiazole-4-carboxamide (PubChem CID 54377306) has the molecular formula C9H14N4O2S2
and a molecular weight of 274.37 g/mol. Its IUPAC name is 5-(ethylcarbamoylamino)-3-ethylsulfanyl-1,2-thiazole-4-carboxamide.
Molecular Properties
| Compound Name | 5-(ethylcarbamoylamino)-3-ethylsulfanyl-1,2-thiazole-4-carboxamide |
| PubChem CID | 54377306 |
| Molecular Formula | C9H14N4O2S2 |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | 5-(ethylcarbamoylamino)-3-ethylsulfanyl-1,2-thiazole-4-carboxamide |
| SMILES | CCNC(=O)Nc1snc(SCC)c1C(N)=O |
| InChI | InChI=1S/C9H14N4O2S2/c1-3-11-9(15)12-7-5(6(10)14)8(13-17-7)16-4-2/h3-4H2,1-2H3,(H2,10,14)(H2,11,12,15) |
| InChIKey | UXKZNEUXFAFOQL-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(ethylcarbamoylamino)-3-ethylsulfanyl-1,2-thiazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(ethylcarbamoylamino)-3-ethylsulfanyl-1,2-thiazole-4-carboxamide?
The IUPAC name of 5-(ethylcarbamoylamino)-3-ethylsulfanyl-1,2-thiazole-4-carboxamide (CID 54377306) is 5-(ethylcarbamoylamino)-3-ethylsulfanyl-1,2-thiazole-4-carboxamide.
What is the SMILES notation for 5-(ethylcarbamoylamino)-3-ethylsulfanyl-1,2-thiazole-4-carboxamide?
The canonical SMILES for 5-(ethylcarbamoylamino)-3-ethylsulfanyl-1,2-thiazole-4-carboxamide is CCNC(=O)Nc1snc(SCC)c1C(N)=O.
What is the InChIKey of 5-(ethylcarbamoylamino)-3-ethylsulfanyl-1,2-thiazole-4-carboxamide?
The InChIKey is UXKZNEUXFAFOQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N4O2S2/c1-3-11-9(15)12-7-5(6(10)14)8(13-17-7)16-4-2/h3-4H2,1-2H3,(H2,10,14)(H2,11,12,15).
What are the key properties of 5-(ethylcarbamoylamino)-3-ethylsulfanyl-1,2-thiazole-4-carboxamide?
5-(ethylcarbamoylamino)-3-ethylsulfanyl-1,2-thiazole-4-carboxamide has a molecular weight of 274.37 g/mol, XLogP of 1.50, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(ethylcarbamoylamino)-3-ethylsulfanyl-1,2-thiazole-4-carboxamide is sourced from PubChem (CID 54377306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).