C12H19N3O3S2 — CID 18550839
5-(ethylcarbamoylamino)-3-pentylsulfanyl-1,2-thiazole-4-carboxylic acid (PubChem CID 18550839) has the molecular formula C12H19N3O3S2 and a molecular weight of 317.44 g/mol. Its IUPAC name is 5-(ethylcarbamoylamino)-3-pentylsulfanyl-1,2-thiazole-4-carboxylic acid.
| Compound Name | 5-(ethylcarbamoylamino)-3-pentylsulfanyl-1,2-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 18550839 |
| Molecular Formula | C12H19N3O3S2 |
| Molecular Weight | 317.44 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | 5-(ethylcarbamoylamino)-3-pentylsulfanyl-1,2-thiazole-4-carboxylic acid |
| SMILES | CCCCCSc1nsc(NC(=O)NCC)c1C(=O)O |
| InChI | InChI=1S/C12H19N3O3S2/c1-3-5-6-7-19-10-8(11(16)17)9(20-15-10)14-12(18)13-4-2/h3-7H2,1-2H3,(H,16,17)(H2,13,14,18) |
| InChIKey | PTMZVYKHNAHNGT-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.44 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|