C14H24N4O3S2 — CID 54426527
3-hexylsulfanyl-5-(2-hydroxypropylcarbamoylamino)-1,2-thiazole-4-carboxamide (PubChem CID 54426527) has the molecular formula C14H24N4O3S2 and a molecular weight of 360.51 g/mol. Its IUPAC name is 3-hexylsulfanyl-5-(2-hydroxypropylcarbamoylamino)-1,2-thiazole-4-carboxamide.
| Compound Name | 3-hexylsulfanyl-5-(2-hydroxypropylcarbamoylamino)-1,2-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 54426527 |
| Molecular Formula | C14H24N4O3S2 |
| Molecular Weight | 360.51 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | 3-hexylsulfanyl-5-(2-hydroxypropylcarbamoylamino)-1,2-thiazole-4-carboxamide |
| SMILES | CCCCCCSc1nsc(NC(=O)NCC(C)O)c1C(N)=O |
| InChI | InChI=1S/C14H24N4O3S2/c1-3-4-5-6-7-22-13-10(11(15)20)12(23-18-13)17-14(21)16-8-9(2)19/h9,19H,3-8H2,1-2H3,(H2,15,20)(H2,16,17,21) |
| InChIKey | WEMHKLXCABMPSS-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 117.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.51 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|