C15H26N4O3S2 — CID 18550927
5-[2-(dimethylamino)ethylcarbamoylamino]-3-hexylsulfanyl-1,2-thiazole-4-carboxylic acid (PubChem CID 18550927) has the molecular formula C15H26N4O3S2 and a molecular weight of 374.53 g/mol. Its IUPAC name is 5-[2-(dimethylamino)ethylcarbamoylamino]-3-hexylsulfanyl-1,2-thiazole-4-carboxylic acid.
| Compound Name | 5-[2-(dimethylamino)ethylcarbamoylamino]-3-hexylsulfanyl-1,2-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 18550927 |
| Molecular Formula | C15H26N4O3S2 |
| Molecular Weight | 374.53 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | 5-[2-(dimethylamino)ethylcarbamoylamino]-3-hexylsulfanyl-1,2-thiazole-4-carboxylic acid |
| SMILES | CCCCCCSc1nsc(NC(=O)NCCN(C)C)c1C(=O)O |
| InChI | InChI=1S/C15H26N4O3S2/c1-4-5-6-7-10-23-13-11(14(20)21)12(24-18-13)17-15(22)16-8-9-19(2)3/h4-10H2,1-3H3,(H,20,21)(H2,16,17,22) |
| InChIKey | NMYKWWLVOWSSFD-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.53 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|