C17H29N3O5S — CID 18549941
3-heptoxy-5-[(3-hydroxy-2,2-dimethylpropyl)carbamoylamino]-1,2-thiazole-4-carboxylic acid (PubChem CID 18549941) has the molecular formula C17H29N3O5S and a molecular weight of 387.50 g/mol. Its IUPAC name is 3-heptoxy-5-[(3-hydroxy-2,2-dimethylpropyl)carbamoylamino]-1,2-thiazole-4-carboxylic acid.
| Compound Name | 3-heptoxy-5-[(3-hydroxy-2,2-dimethylpropyl)carbamoylamino]-1,2-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 18549941 |
| Molecular Formula | C17H29N3O5S |
| Molecular Weight | 387.50 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | 3-heptoxy-5-[(3-hydroxy-2,2-dimethylpropyl)carbamoylamino]-1,2-thiazole-4-carboxylic acid |
| SMILES | CCCCCCCOc1nsc(NC(=O)NCC(C)(C)CO)c1C(=O)O |
| InChI | InChI=1S/C17H29N3O5S/c1-4-5-6-7-8-9-25-13-12(15(22)23)14(26-20-13)19-16(24)18-10-17(2,3)11-21/h21H,4-11H2,1-3H3,(H,22,23)(H2,18,19,24) |
| InChIKey | MJBAKAUBUUUWGU-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 120.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.50 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|