C13H22N4O2S2 — CID 54260790
5-(dimethylcarbamoylamino)-3-(4-methylpentylsulfanyl)-1,2-thiazole-4-carboxamide (PubChem CID 54260790) has the molecular formula C13H22N4O2S2 and a molecular weight of 330.48 g/mol. Its IUPAC name is 5-(dimethylcarbamoylamino)-3-(4-methylpentylsulfanyl)-1,2-thiazole-4-carboxamide.
| Compound Name | 5-(dimethylcarbamoylamino)-3-(4-methylpentylsulfanyl)-1,2-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 54260790 |
| Molecular Formula | C13H22N4O2S2 |
| Molecular Weight | 330.48 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | 5-(dimethylcarbamoylamino)-3-(4-methylpentylsulfanyl)-1,2-thiazole-4-carboxamide |
| SMILES | CC(C)CCCSc1nsc(NC(=O)N(C)C)c1C(N)=O |
| InChI | InChI=1S/C13H22N4O2S2/c1-8(2)6-5-7-20-12-9(10(14)18)11(21-16-12)15-13(19)17(3)4/h8H,5-7H2,1-4H3,(H2,14,18)(H,15,19) |
| InChIKey | RDIVKYUQQZXHLS-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.48 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|