C14H25N3O2S2 — CID 159481450
4-hexylsulfanyl-2-(methylcarbamoylamino)thiophene-3-carboxamide;methane (PubChem CID 159481450) has the molecular formula C14H25N3O2S2 and a molecular weight of 331.51 g/mol. Its IUPAC name is 4-hexylsulfanyl-2-(methylcarbamoylamino)thiophene-3-carboxamide;methane.
| Compound Name | 4-hexylsulfanyl-2-(methylcarbamoylamino)thiophene-3-carboxamide;methane |
|---|---|
| PubChem CID | 159481450 |
| Molecular Formula | C14H25N3O2S2 |
| Molecular Weight | 331.51 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | 4-hexylsulfanyl-2-(methylcarbamoylamino)thiophene-3-carboxamide;methane |
| SMILES | C.CCCCCCSc1csc(NC(=O)NC)c1C(N)=O |
| InChI | InChI=1S/C13H21N3O2S2.CH4/c1-3-4-5-6-7-19-9-8-20-12(10(9)11(14)17)16-13(18)15-2;/h8H,3-7H2,1-2H3,(H2,14,17)(H2,15,16,18);1H4 |
| InChIKey | LXBBANIPZOPNJD-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.51 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|