C16H22N6O3S — CID 66679258
5-[3-(dimethylamino)propylcarbamoylamino]-3-(pyridin-3-ylmethoxy)-1,2-thiazole-4-carboxamide (PubChem CID 66679258) has the molecular formula C16H22N6O3S and a molecular weight of 378.46 g/mol. Its IUPAC name is 5-[3-(dimethylamino)propylcarbamoylamino]-3-(pyridin-3-ylmethoxy)-1,2-thiazole-4-carboxamide.
| Compound Name | 5-[3-(dimethylamino)propylcarbamoylamino]-3-(pyridin-3-ylmethoxy)-1,2-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 66679258 |
| Molecular Formula | C16H22N6O3S |
| Molecular Weight | 378.46 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | 5-[3-(dimethylamino)propylcarbamoylamino]-3-(pyridin-3-ylmethoxy)-1,2-thiazole-4-carboxamide |
| SMILES | CN(C)CCCNC(=O)Nc1snc(OCc2cccnc2)c1C(N)=O |
| InChI | InChI=1S/C16H22N6O3S/c1-22(2)8-4-7-19-16(24)20-15-12(13(17)23)14(21-26-15)25-10-11-5-3-6-18-9-11/h3,5-6,9H,4,7-8,10H2,1-2H3,(H2,17,23)(H2,19,20,24) |
| InChIKey | JVJVJWJDVRQBSR-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 122.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.46 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|