C19H26FN5O3S — CID 68507353
5-[2-(butan-2-ylamino)ethylcarbamoylamino]-3-[[2-(fluoromethyl)phenyl]methoxy]-1,2-thiazole-4-carboxamide (PubChem CID 68507353) has the molecular formula C19H26FN5O3S and a molecular weight of 423.51 g/mol. Its IUPAC name is 5-[2-(butan-2-ylamino)ethylcarbamoylamino]-3-[[2-(fluoromethyl)phenyl]methoxy]-1,2-thiazole-4-carboxamide.
| Compound Name | 5-[2-(butan-2-ylamino)ethylcarbamoylamino]-3-[[2-(fluoromethyl)phenyl]methoxy]-1,2-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 68507353 |
| Molecular Formula | C19H26FN5O3S |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | 5-[2-(butan-2-ylamino)ethylcarbamoylamino]-3-[[2-(fluoromethyl)phenyl]methoxy]-1,2-thiazole-4-carboxamide |
| SMILES | CCC(C)NCCNC(=O)Nc1snc(OCc2ccccc2CF)c1C(N)=O |
| InChI | InChI=1S/C19H26FN5O3S/c1-3-12(2)22-8-9-23-19(27)24-18-15(16(21)26)17(25-29-18)28-11-14-7-5-4-6-13(14)10-20/h4-7,12,22H,3,8-11H2,1-2H3,(H2,21,26)(H2,23,24,27) |
| InChIKey | ODTGPLPZPDQNJP-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 118.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|