C20H25F2N5O3S — CID 68509566
3-[[2,5-bis(fluoromethyl)phenyl]methoxy]-5-[3-(cyclopropylamino)propylcarbamoylamino]-1,2-thiazole-4-carboxamide (PubChem CID 68509566) has the molecular formula C20H25F2N5O3S and a molecular weight of 453.52 g/mol. Its IUPAC name is 3-[[2,5-bis(fluoromethyl)phenyl]methoxy]-5-[3-(cyclopropylamino)propylcarbamoylamino]-1,2-thiazole-4-carboxamide.
| Compound Name | 3-[[2,5-bis(fluoromethyl)phenyl]methoxy]-5-[3-(cyclopropylamino)propylcarbamoylamino]-1,2-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 68509566 |
| Molecular Formula | C20H25F2N5O3S |
| Molecular Weight | 453.52 g/mol |
| Exact Mass | 453.16 |
| IUPAC Name | 3-[[2,5-bis(fluoromethyl)phenyl]methoxy]-5-[3-(cyclopropylamino)propylcarbamoylamino]-1,2-thiazole-4-carboxamide |
| SMILES | NC(=O)c1c(OCc2cc(CF)ccc2CF)nsc1NC(=O)NCCCNC1CC1 |
| InChI | InChI=1S/C20H25F2N5O3S/c21-9-12-2-3-13(10-22)14(8-12)11-30-18-16(17(23)28)19(31-27-18)26-20(29)25-7-1-6-24-15-4-5-15/h2-3,8,15,24H,1,4-7,9-11H2,(H2,23,28)(H2,25,26,29) |
| InChIKey | GUYHYYWIIRZGLU-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 118.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.52 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|