C20H28N6O3S — CID 10094351
5-[3-(2-methylpiperidin-1-yl)propylcarbamoylamino]-3-(pyridin-3-ylmethoxy)-1,2-thiazole-4-carboxamide (PubChem CID 10094351) has the molecular formula C20H28N6O3S and a molecular weight of 432.55 g/mol. Its IUPAC name is 5-[3-(2-methylpiperidin-1-yl)propylcarbamoylamino]-3-(pyridin-3-ylmethoxy)-1,2-thiazole-4-carboxamide.
| Compound Name | 5-[3-(2-methylpiperidin-1-yl)propylcarbamoylamino]-3-(pyridin-3-ylmethoxy)-1,2-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 10094351 |
| Molecular Formula | C20H28N6O3S |
| Molecular Weight | 432.55 g/mol |
| Exact Mass | 432.19 |
| IUPAC Name | 5-[3-(2-methylpiperidin-1-yl)propylcarbamoylamino]-3-(pyridin-3-ylmethoxy)-1,2-thiazole-4-carboxamide |
| SMILES | CC1CCCCN1CCCNC(=O)Nc1snc(OCc2cccnc2)c1C(N)=O |
| InChI | InChI=1S/C20H28N6O3S/c1-14-6-2-3-10-26(14)11-5-9-23-20(28)24-19-16(17(21)27)18(25-30-19)29-13-15-7-4-8-22-12-15/h4,7-8,12,14H,2-3,5-6,9-11,13H2,1H3,(H2,21,27)(H2,23,24,28) |
| InChIKey | OXGMMSPGYQRNAR-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 122.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.55 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|