C21H20ClF2N5O4S — CID 18550666
3-[(4-chloro-2,6-difluorophenyl)methoxy]-5-[4-(pyridin-4-ylamino)butylcarbamoylamino]-1,2-thiazole-4-carboxylic acid (PubChem CID 18550666) has the molecular formula C21H20ClF2N5O4S and a molecular weight of 511.94 g/mol. Its IUPAC name is 3-[(4-chloro-2,6-difluorophenyl)methoxy]-5-[4-(pyridin-4-ylamino)butylcarbamoylamino]-1,2-thiazole-4-carboxylic acid.
| Compound Name | 3-[(4-chloro-2,6-difluorophenyl)methoxy]-5-[4-(pyridin-4-ylamino)butylcarbamoylamino]-1,2-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 18550666 |
| Molecular Formula | C21H20ClF2N5O4S |
| Molecular Weight | 511.94 g/mol |
| Exact Mass | 511.09 |
| IUPAC Name | 3-[(4-chloro-2,6-difluorophenyl)methoxy]-5-[4-(pyridin-4-ylamino)butylcarbamoylamino]-1,2-thiazole-4-carboxylic acid |
| SMILES | O=C(NCCCCNc1ccncc1)Nc1snc(OCc2c(F)cc(Cl)cc2F)c1C(=O)O |
| InChI | InChI=1S/C21H20ClF2N5O4S/c22-12-9-15(23)14(16(24)10-12)11-33-18-17(20(30)31)19(34-29-18)28-21(32)27-6-2-1-5-26-13-3-7-25-8-4-13/h3-4,7-10H,1-2,5-6,11H2,(H,25,26)(H,30,31)(H2,27,28,32) |
| InChIKey | RLNQFTCZWCASDG-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 125.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.94 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|