C22H27ClF2N6O3S — CID 54110897
5-[2-(2,3,4,6,7,8,9,9a-octahydro-1H-pyrido[1,2-a]pyrazin-7-yl)ethylcarbamoylamino]-3-[(4-chloro-2,5-difluorophenyl)methoxy]-1,2-thiazole-4-carboxamide (PubChem CID 54110897) has the molecular formula C22H27ClF2N6O3S and a molecular weight of 529.01 g/mol. Its IUPAC name is 5-[2-(2,3,4,6,7,8,9,9a-octahydro-1H-pyrido[1,2-a]pyrazin-7-yl)ethylcarbamoylamino]-3-[(4-chloro-2,5-difluorophenyl)methoxy]-1,2-thiazole-4-carboxamide.
| Compound Name | 5-[2-(2,3,4,6,7,8,9,9a-octahydro-1H-pyrido[1,2-a]pyrazin-7-yl)ethylcarbamoylamino]-3-[(4-chloro-2,5-difluorophenyl)methoxy]-1,2-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 54110897 |
| Molecular Formula | C22H27ClF2N6O3S |
| Molecular Weight | 529.01 g/mol |
| Exact Mass | 528.15 |
| IUPAC Name | 5-[2-(2,3,4,6,7,8,9,9a-octahydro-1H-pyrido[1,2-a]pyrazin-7-yl)ethylcarbamoylamino]-3-[(4-chloro-2,5-difluorophenyl)methoxy]-1,2-thiazole-4-carboxamide |
| SMILES | NC(=O)c1c(OCc2cc(F)c(Cl)cc2F)nsc1NC(=O)NCCC1CCC2CNCCN2C1 |
| InChI | InChI=1S/C22H27ClF2N6O3S/c23-15-8-16(24)13(7-17(15)25)11-34-20-18(19(26)32)21(35-30-20)29-22(33)28-4-3-12-1-2-14-9-27-5-6-31(14)10-12/h7-8,12,14,27H,1-6,9-11H2,(H2,26,32)(H2,28,29,33) |
| InChIKey | NGZYSVVTYHVYKQ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 121.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.01 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|