C22H28F2N6O3S — CID 68509451
5-(2,3,4,6,7,8,9,9a-octahydro-1H-pyrido[1,2-a]pyrazin-7-ylmethylcarbamoylamino)-3-[(2,5-difluoro-4-methylphenyl)methoxy]-1,2-thiazole-4-carboxamide (PubChem CID 68509451) has the molecular formula C22H28F2N6O3S and a molecular weight of 494.57 g/mol. Its IUPAC name is 5-(2,3,4,6,7,8,9,9a-octahydro-1H-pyrido[1,2-a]pyrazin-7-ylmethylcarbamoylamino)-3-[(2,5-difluoro-4-methylphenyl)methoxy]-1,2-thiazole-4-carboxamide.
| Compound Name | 5-(2,3,4,6,7,8,9,9a-octahydro-1H-pyrido[1,2-a]pyrazin-7-ylmethylcarbamoylamino)-3-[(2,5-difluoro-4-methylphenyl)methoxy]-1,2-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 68509451 |
| Molecular Formula | C22H28F2N6O3S |
| Molecular Weight | 494.57 g/mol |
| Exact Mass | 494.19 |
| IUPAC Name | 5-(2,3,4,6,7,8,9,9a-octahydro-1H-pyrido[1,2-a]pyrazin-7-ylmethylcarbamoylamino)-3-[(2,5-difluoro-4-methylphenyl)methoxy]-1,2-thiazole-4-carboxamide |
| SMILES | Cc1cc(F)c(COc2nsc(NC(=O)NCC3CCC4CNCCN4C3)c2C(N)=O)cc1F |
| InChI | InChI=1S/C22H28F2N6O3S/c1-12-6-17(24)14(7-16(12)23)11-33-20-18(19(25)31)21(34-29-20)28-22(32)27-8-13-2-3-15-9-26-4-5-30(15)10-13/h6-7,13,15,26H,2-5,8-11H2,1H3,(H2,25,31)(H2,27,28,32) |
| InChIKey | HCHDFEIPJXWFMK-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 121.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.57 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |