C12H15N3O3 — CID 75508665
1-(2,4-dimethyl-5-nitrophenyl)-3-prop-2-enylurea (PubChem CID 75508665) has the molecular formula C12H15N3O3 and a molecular weight of 249.27 g/mol. Its IUPAC name is 1-(2,4-dimethyl-5-nitrophenyl)-3-prop-2-enylurea.
| Compound Name | 1-(2,4-dimethyl-5-nitrophenyl)-3-prop-2-enylurea |
|---|---|
| PubChem CID | 75508665 |
| Molecular Formula | C12H15N3O3 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.11 |
| IUPAC Name | 1-(2,4-dimethyl-5-nitrophenyl)-3-prop-2-enylurea |
| SMILES | C=CCNC(=O)Nc1cc([N+](=O)[O-])c(C)cc1C |
| InChI | InChI=1S/C12H15N3O3/c1-4-5-13-12(16)14-10-7-11(15(17)18)9(3)6-8(10)2/h4,6-7H,1,5H2,2-3H3,(H2,13,14,16) |
| InChIKey | GRGPDLHRCFCWKL-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|