C11H14BrN3O4 — CID 75503857
1-(2-bromo-4-methyl-5-nitrophenyl)-3-(3-hydroxypropyl)urea (PubChem CID 75503857) has the molecular formula C11H14BrN3O4 and a molecular weight of 332.15 g/mol. Its IUPAC name is 1-(2-bromo-4-methyl-5-nitrophenyl)-3-(3-hydroxypropyl)urea.
| Compound Name | 1-(2-bromo-4-methyl-5-nitrophenyl)-3-(3-hydroxypropyl)urea |
|---|---|
| PubChem CID | 75503857 |
| Molecular Formula | C11H14BrN3O4 |
| Molecular Weight | 332.15 g/mol |
| Exact Mass | 331.02 |
| IUPAC Name | 1-(2-bromo-4-methyl-5-nitrophenyl)-3-(3-hydroxypropyl)urea |
| SMILES | Cc1cc(Br)c(NC(=O)NCCCO)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H14BrN3O4/c1-7-5-8(12)9(6-10(7)15(18)19)14-11(17)13-3-2-4-16/h5-6,16H,2-4H2,1H3,(H2,13,14,17) |
| InChIKey | YOFPTLJAPMVQGN-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 104.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.15 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|