C12H14BrN3O5 — CID 104815405
2-[(2-bromo-4-methyl-5-nitrophenyl)carbamoylamino]-2-methylpropanoic acid (PubChem CID 104815405) has the molecular formula C12H14BrN3O5 and a molecular weight of 360.16 g/mol. Its IUPAC name is 2-[(2-bromo-4-methyl-5-nitrophenyl)carbamoylamino]-2-methylpropanoic acid.
| Compound Name | 2-[(2-bromo-4-methyl-5-nitrophenyl)carbamoylamino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 104815405 |
| Molecular Formula | C12H14BrN3O5 |
| Molecular Weight | 360.16 g/mol |
| Exact Mass | 359.01 |
| IUPAC Name | 2-[(2-bromo-4-methyl-5-nitrophenyl)carbamoylamino]-2-methylpropanoic acid |
| SMILES | Cc1cc(Br)c(NC(=O)NC(C)(C)C(=O)O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H14BrN3O5/c1-6-4-7(13)8(5-9(6)16(20)21)14-11(19)15-12(2,3)10(17)18/h4-5H,1-3H3,(H,17,18)(H2,14,15,19) |
| InChIKey | IKJUHNOVLVLGRG-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 121.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.16 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|