C11H14BrN3O4 — CID 104815312
2-(2-aminoethoxy)-N-(2-bromo-4-methyl-5-nitrophenyl)acetamide (PubChem CID 104815312) has the molecular formula C11H14BrN3O4 and a molecular weight of 332.15 g/mol. Its IUPAC name is 2-(2-aminoethoxy)-N-(2-bromo-4-methyl-5-nitrophenyl)acetamide.
| Compound Name | 2-(2-aminoethoxy)-N-(2-bromo-4-methyl-5-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 104815312 |
| Molecular Formula | C11H14BrN3O4 |
| Molecular Weight | 332.15 g/mol |
| Exact Mass | 331.02 |
| IUPAC Name | 2-(2-aminoethoxy)-N-(2-bromo-4-methyl-5-nitrophenyl)acetamide |
| SMILES | Cc1cc(Br)c(NC(=O)COCCN)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H14BrN3O4/c1-7-4-8(12)9(5-10(7)15(17)18)14-11(16)6-19-3-2-13/h4-5H,2-3,6,13H2,1H3,(H,14,16) |
| InChIKey | BOYMKDGNQJOFCD-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 107.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.15 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|