C10H13N3O5 — CID 79473716
2-(2-aminoethoxy)-N-(4-hydroxy-2-nitrophenyl)acetamide (PubChem CID 79473716) has the molecular formula C10H13N3O5 and a molecular weight of 255.23 g/mol. Its IUPAC name is 2-(2-aminoethoxy)-N-(4-hydroxy-2-nitrophenyl)acetamide.
| Compound Name | 2-(2-aminoethoxy)-N-(4-hydroxy-2-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 79473716 |
| Molecular Formula | C10H13N3O5 |
| Molecular Weight | 255.23 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | 2-(2-aminoethoxy)-N-(4-hydroxy-2-nitrophenyl)acetamide |
| SMILES | NCCOCC(=O)Nc1ccc(O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H13N3O5/c11-3-4-18-6-10(15)12-8-2-1-7(14)5-9(8)13(16)17/h1-2,5,14H,3-4,6,11H2,(H,12,15) |
| InChIKey | TURVYGISCHVZIF-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 127.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.23 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|