C13H19N3O3S — CID 104909036
(2R)-2-amino-N-(2,4-dimethyl-5-nitrophenyl)-4-methylsulfanylbutanamide (PubChem CID 104909036) has the molecular formula C13H19N3O3S and a molecular weight of 297.38 g/mol. Its IUPAC name is (2R)-2-amino-N-(2,4-dimethyl-5-nitrophenyl)-4-methylsulfanylbutanamide.
| Compound Name | (2R)-2-amino-N-(2,4-dimethyl-5-nitrophenyl)-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 104909036 |
| Molecular Formula | C13H19N3O3S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | (2R)-2-amino-N-(2,4-dimethyl-5-nitrophenyl)-4-methylsulfanylbutanamide |
| SMILES | CSCC[C@@H](N)C(=O)Nc1cc([N+](=O)[O-])c(C)cc1C |
| InChI | InChI=1S/C13H19N3O3S/c1-8-6-9(2)12(16(18)19)7-11(8)15-13(17)10(14)4-5-20-3/h6-7,10H,4-5,14H2,1-3H3,(H,15,17)/t10-/m1/s1 |
| InChIKey | AKBFWUHPPLGCJE-SNVBAGLBSA-N |
| XLogP | 2.23 |
| TPSA | 98.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|