C12H17N3O4S — CID 61178396
(2S)-2-amino-N-(4-methoxy-2-nitrophenyl)-4-methylsulfanylbutanamide (PubChem CID 61178396) has the molecular formula C12H17N3O4S and a molecular weight of 299.35 g/mol. Its IUPAC name is (2S)-2-amino-N-(4-methoxy-2-nitrophenyl)-4-methylsulfanylbutanamide.
| Compound Name | (2S)-2-amino-N-(4-methoxy-2-nitrophenyl)-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 61178396 |
| Molecular Formula | C12H17N3O4S |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | (2S)-2-amino-N-(4-methoxy-2-nitrophenyl)-4-methylsulfanylbutanamide |
| SMILES | COc1ccc(NC(=O)[C@@H](N)CCSC)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H17N3O4S/c1-19-8-3-4-10(11(7-8)15(17)18)14-12(16)9(13)5-6-20-2/h3-4,7,9H,5-6,13H2,1-2H3,(H,14,16)/t9-/m0/s1 |
| InChIKey | SGSCLCWPBKWQJJ-VIFPVBQESA-N |
| XLogP | 1.62 |
| TPSA | 107.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|