C13H15N5O3 — CID 103011164
5-amino-N-[2-(2-methylpyrazol-3-yl)ethyl]-2-nitrobenzamide (PubChem CID 103011164) has the molecular formula C13H15N5O3 and a molecular weight of 289.30 g/mol. Its IUPAC name is 5-amino-N-[2-(2-methylpyrazol-3-yl)ethyl]-2-nitrobenzamide.
| Compound Name | 5-amino-N-[2-(2-methylpyrazol-3-yl)ethyl]-2-nitrobenzamide |
|---|---|
| PubChem CID | 103011164 |
| Molecular Formula | C13H15N5O3 |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | 5-amino-N-[2-(2-methylpyrazol-3-yl)ethyl]-2-nitrobenzamide |
| SMILES | Cn1nccc1CCNC(=O)c1cc(N)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H15N5O3/c1-17-10(5-7-16-17)4-6-15-13(19)11-8-9(14)2-3-12(11)18(20)21/h2-3,5,7-8H,4,6,14H2,1H3,(H,15,19) |
| InChIKey | LZFGYJWBBYUWRN-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 116.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|