C23H29N3O3 — CID 23068152
tert-butyl N-[2-[benzyl(methyl)amino]ethyl]-N-(4-cyano-3-methoxyphenyl)carbamate (PubChem CID 23068152) has the molecular formula C23H29N3O3 and a molecular weight of 395.50 g/mol. Its IUPAC name is tert-butyl N-[2-[benzyl(methyl)amino]ethyl]-N-(4-cyano-3-methoxyphenyl)carbamate.
| Compound Name | tert-butyl N-[2-[benzyl(methyl)amino]ethyl]-N-(4-cyano-3-methoxyphenyl)carbamate |
|---|---|
| PubChem CID | 23068152 |
| Molecular Formula | C23H29N3O3 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.22 |
| IUPAC Name | tert-butyl N-[2-[benzyl(methyl)amino]ethyl]-N-(4-cyano-3-methoxyphenyl)carbamate |
| SMILES | COc1cc(N(CCN(C)Cc2ccccc2)C(=O)OC(C)(C)C)ccc1C#N |
| InChI | InChI=1S/C23H29N3O3/c1-23(2,3)29-22(27)26(20-12-11-19(16-24)21(15-20)28-5)14-13-25(4)17-18-9-7-6-8-10-18/h6-12,15H,13-14,17H2,1-5H3 |
| InChIKey | MLHGFJHWNWGBOV-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 65.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |