C24H25IN2O4 — CID 22053380
tert-butyl N-(5-iodo-8-phenylmethoxyquinolin-6-yl)-N-(3-oxopropyl)carbamate (PubChem CID 22053380) has the molecular formula C24H25IN2O4 and a molecular weight of 532.38 g/mol. Its IUPAC name is tert-butyl N-(5-iodo-8-phenylmethoxyquinolin-6-yl)-N-(3-oxopropyl)carbamate.
| Compound Name | tert-butyl N-(5-iodo-8-phenylmethoxyquinolin-6-yl)-N-(3-oxopropyl)carbamate |
|---|---|
| PubChem CID | 22053380 |
| Molecular Formula | C24H25IN2O4 |
| Molecular Weight | 532.38 g/mol |
| Exact Mass | 532.09 |
| IUPAC Name | tert-butyl N-(5-iodo-8-phenylmethoxyquinolin-6-yl)-N-(3-oxopropyl)carbamate |
| SMILES | CC(C)(C)OC(=O)N(CCC=O)c1cc(OCc2ccccc2)c2ncccc2c1I |
| InChI | InChI=1S/C24H25IN2O4/c1-24(2,3)31-23(29)27(13-8-14-28)19-15-20(30-16-17-9-5-4-6-10-17)22-18(21(19)25)11-7-12-26-22/h4-7,9-12,14-15H,8,13,16H2,1-3H3 |
| InChIKey | TZAQLWDZAGTDSW-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.38 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|