C19H19BrN2O4S — CID 131735048
tert-butyl N-(benzenesulfonylmethyl)-N-(2-bromo-4-cyanophenyl)carbamate (PubChem CID 131735048) has the molecular formula C19H19BrN2O4S and a molecular weight of 451.34 g/mol. Its IUPAC name is tert-butyl N-(benzenesulfonylmethyl)-N-(2-bromo-4-cyanophenyl)carbamate.
| Compound Name | tert-butyl N-(benzenesulfonylmethyl)-N-(2-bromo-4-cyanophenyl)carbamate |
|---|---|
| PubChem CID | 131735048 |
| Molecular Formula | C19H19BrN2O4S |
| Molecular Weight | 451.34 g/mol |
| Exact Mass | 450.02 |
| IUPAC Name | tert-butyl N-(benzenesulfonylmethyl)-N-(2-bromo-4-cyanophenyl)carbamate |
| SMILES | CC(C)(C)OC(=O)N(CS(=O)(=O)c1ccccc1)c1ccc(C#N)cc1Br |
| InChI | InChI=1S/C19H19BrN2O4S/c1-19(2,3)26-18(23)22(17-10-9-14(12-21)11-16(17)20)13-27(24,25)15-7-5-4-6-8-15/h4-11H,13H2,1-3H3 |
| InChIKey | NAZLUOHHWYQHST-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 87.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.34 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |