C18H27N3O5 — CID 90688542
tert-butyl N-[4-(hydroxymethyl)phenyl]-N-[N'-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate (PubChem CID 90688542) has the molecular formula C18H27N3O5 and a molecular weight of 365.43 g/mol. Its IUPAC name is tert-butyl N-[4-(hydroxymethyl)phenyl]-N-[N'-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate.
| Compound Name | tert-butyl N-[4-(hydroxymethyl)phenyl]-N-[N'-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate |
|---|---|
| PubChem CID | 90688542 |
| Molecular Formula | C18H27N3O5 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | tert-butyl N-[4-(hydroxymethyl)phenyl]-N-[N'-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N=C(N)N(C(=O)OC(C)(C)C)c1ccc(CO)cc1 |
| InChI | InChI=1S/C18H27N3O5/c1-17(2,3)25-15(23)20-14(19)21(16(24)26-18(4,5)6)13-9-7-12(11-22)8-10-13/h7-10,22H,11H2,1-6H3,(H2,19,20,23) |
| InChIKey | MDGUEBCBGIVMEK-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 114.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|