C19H27N7O5 — CID 67373814
tert-butyl N-[3-[hydroxy(2H-tetrazol-5-yl)methyl]phenyl]-N-[N'-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate (PubChem CID 67373814) has the molecular formula C19H27N7O5 and a molecular weight of 433.47 g/mol. Its IUPAC name is tert-butyl N-[3-[hydroxy(2H-tetrazol-5-yl)methyl]phenyl]-N-[N'-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate.
| Compound Name | tert-butyl N-[3-[hydroxy(2H-tetrazol-5-yl)methyl]phenyl]-N-[N'-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate |
|---|---|
| PubChem CID | 67373814 |
| Molecular Formula | C19H27N7O5 |
| Molecular Weight | 433.47 g/mol |
| Exact Mass | 433.21 |
| IUPAC Name | tert-butyl N-[3-[hydroxy(2H-tetrazol-5-yl)methyl]phenyl]-N-[N'-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N=C(N)N(C(=O)OC(C)(C)C)c1cccc(C(O)c2nn[nH]n2)c1 |
| InChI | InChI=1S/C19H27N7O5/c1-18(2,3)30-16(28)21-15(20)26(17(29)31-19(4,5)6)12-9-7-8-11(10-12)13(27)14-22-24-25-23-14/h7-10,13,27H,1-6H3,(H2,20,21,28)(H,22,23,24,25) |
| InChIKey | PJJZCNCNCWQGIT-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 168.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.47 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|