C24H40BrN3O5Si — CID 59470546
tert-butyl N-[[3-bromo-4-[tert-butyl(dimethyl)silyl]oxyphenyl]methyl]-N-[N'-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate (PubChem CID 59470546) has the molecular formula C24H40BrN3O5Si and a molecular weight of 558.59 g/mol. Its IUPAC name is tert-butyl N-[[3-bromo-4-[tert-butyl(dimethyl)silyl]oxyphenyl]methyl]-N-[N'-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate.
| Compound Name | tert-butyl N-[[3-bromo-4-[tert-butyl(dimethyl)silyl]oxyphenyl]methyl]-N-[N'-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate |
|---|---|
| PubChem CID | 59470546 |
| Molecular Formula | C24H40BrN3O5Si |
| Molecular Weight | 558.59 g/mol |
| Exact Mass | 557.19 |
| IUPAC Name | tert-butyl N-[[3-bromo-4-[tert-butyl(dimethyl)silyl]oxyphenyl]methyl]-N-[N'-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N=C(N)N(Cc1ccc(O[Si](C)(C)C(C)(C)C)c(Br)c1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H40BrN3O5Si/c1-22(2,3)31-20(29)27-19(26)28(21(30)32-23(4,5)6)15-16-12-13-18(17(25)14-16)33-34(10,11)24(7,8)9/h12-14H,15H2,1-11H3,(H2,26,27,29) |
| InChIKey | CEKCUVYDRGQQQF-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 103.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.59 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|