C14H20N4O3 — CID 72985780
tert-butyl N-[amino-(benzylcarbamoylamino)methylidene]carbamate (PubChem CID 72985780) has the molecular formula C14H20N4O3 and a molecular weight of 292.34 g/mol. Its IUPAC name is tert-butyl N-[amino-(benzylcarbamoylamino)methylidene]carbamate.
| Compound Name | tert-butyl N-[amino-(benzylcarbamoylamino)methylidene]carbamate |
|---|---|
| PubChem CID | 72985780 |
| Molecular Formula | C14H20N4O3 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | tert-butyl N-[amino-(benzylcarbamoylamino)methylidene]carbamate |
| SMILES | CC(C)(C)OC(=O)N=C(N)NC(=O)NCc1ccccc1 |
| InChI | InChI=1S/C14H20N4O3/c1-14(2,3)21-13(20)18-11(15)17-12(19)16-9-10-7-5-4-6-8-10/h4-8H,9H2,1-3H3,(H4,15,16,17,18,19,20) |
| InChIKey | GVHHULBUNIRLOW-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 105.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|