C22H27F3N6O5S — CID 22943453
N-[5-(diaminomethylideneamino)-1-oxopentan-2-yl]-2-[6-methyl-2-oxo-3-[[2-(trifluoromethyl)phenyl]methylsulfonylamino]-1-pyridinyl]acetamide (PubChem CID 22943453) has the molecular formula C22H27F3N6O5S and a molecular weight of 544.56 g/mol. Its IUPAC name is N-[5-(diaminomethylideneamino)-1-oxopentan-2-yl]-2-[6-methyl-2-oxo-3-[[2-(trifluoromethyl)phenyl]methylsulfonylamino]-1-pyridinyl]acetamide.
| Compound Name | N-[5-(diaminomethylideneamino)-1-oxopentan-2-yl]-2-[6-methyl-2-oxo-3-[[2-(trifluoromethyl)phenyl]methylsulfonylamino]-1-pyridinyl]acetamide |
|---|---|
| PubChem CID | 22943453 |
| Molecular Formula | C22H27F3N6O5S |
| Molecular Weight | 544.56 g/mol |
| Exact Mass | 544.17 |
| IUPAC Name | N-[5-(diaminomethylideneamino)-1-oxopentan-2-yl]-2-[6-methyl-2-oxo-3-[[2-(trifluoromethyl)phenyl]methylsulfonylamino]-1-pyridinyl]acetamide |
| SMILES | Cc1ccc(NS(=O)(=O)Cc2ccccc2C(F)(F)F)c(=O)n1CC(=O)NC(C=O)CCCN=C(N)N |
| InChI | InChI=1S/C22H27F3N6O5S/c1-14-8-9-18(30-37(35,36)13-15-5-2-3-7-17(15)22(23,24)25)20(34)31(14)11-19(33)29-16(12-32)6-4-10-28-21(26)27/h2-3,5,7-9,12,16,30H,4,6,10-11,13H2,1H3,(H,29,33)(H4,26,27,28) |
| InChIKey | DGIBJLNNMDHQTE-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 178.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.56 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|