C22H36N8O5S — CID 101001340
(2R)-N-[2-[[(2S)-6-amino-6-imino-1-oxohexan-2-yl]amino]-2-oxoethyl]-2-(benzylsulfonylamino)-5-(diaminomethylideneamino)-N-methylpentanamide (PubChem CID 101001340) has the molecular formula C22H36N8O5S and a molecular weight of 524.65 g/mol. Its IUPAC name is (2R)-N-[2-[[(2S)-6-amino-6-imino-1-oxohexan-2-yl]amino]-2-oxoethyl]-2-(benzylsulfonylamino)-5-(diaminomethylideneamino)-N-methylpentanamide.
| Compound Name | (2R)-N-[2-[[(2S)-6-amino-6-imino-1-oxohexan-2-yl]amino]-2-oxoethyl]-2-(benzylsulfonylamino)-5-(diaminomethylideneamino)-N-methylpentanamide |
|---|---|
| PubChem CID | 101001340 |
| Molecular Formula | C22H36N8O5S |
| Molecular Weight | 524.65 g/mol |
| Exact Mass | 524.25 |
| IUPAC Name | (2R)-N-[2-[[(2S)-6-amino-6-imino-1-oxohexan-2-yl]amino]-2-oxoethyl]-2-(benzylsulfonylamino)-5-(diaminomethylideneamino)-N-methylpentanamide |
| SMILES | [H]/N=C(\N)CCC[C@@H](C=O)NC(=O)CN(C)C(=O)[C@@H](CCCN=C(N)N)NS(=O)(=O)Cc1ccccc1 |
| InChI | InChI=1S/C22H36N8O5S/c1-30(13-20(32)28-17(14-31)9-5-11-19(23)24)21(33)18(10-6-12-27-22(25)26)29-36(34,35)15-16-7-3-2-4-8-16/h2-4,7-8,14,17-18,29H,5-6,9-13,15H2,1H3,(H3,23,24)(H,28,32)(H4,25,26,27)/t17-,18+/m0/s1 |
| InChIKey | VKZQMJABYBLVIU-ZWKOTPCHSA-N |
| XLogP | -1.22 |
| TPSA | 226.92 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.65 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|